Gas Laws: Partial pressure

Consider the reaction shown in this balanced chemical equation:
SiO2(s)+2H2O(g)SiH4(g)+2O2(g)SiO_2(s)+2H_2O(g)→SiH_4(g)+2O_2 (g)
A rigid flask is filled with 0.20 mol SiO2 (s) and 0.40 mol H2O (g). The initial partial pressure of H2O (g) is 1.0 atm. If the reaction goes to completion and the temperature stays constant, what is the final total pressure in the flask?

More Gas Mixtures & Partial Pressures Questions: