Aspirin is produced by the reaction of salicylic acid, C_7H_6O_3, and acetic a…

Aspirin is produced by the reaction of salicylic acid, C7H6O3\rm C_7H_6O_3, and acetic anhydride, C4H6O3\rm C_4H_6O_3
C7H6O3(s)+C4H6O3(l)C9H8O4(s)+C2H4O2(l)\rm C_7H_6O_3(s)+C_4H_6O_3(l)\rightarrow C_9H_8O_4(s)+C_2H_4O_2(l)

If 2.04 g of C9H8O4\rm C_9H_8O_4 is produced from the reaction of 3.03 g C7H6O3\rm C_7H_6O_3 and 4.01 g C4H6O3\rm C_4H_6O_3, what is the percent yield?


More Percent Yield Questions: